C23H21N3OS3 — CID 142989852
(2E,4Z)-5-ethylsulfanyl-5-[6-methyl-3-[(1Z)-1-sulfanylbuta-1,3-dienyl]-2-thiophen-2-ylpyrido[2,3-b]pyrazin-7-yl]penta-2,4-dienal (PubChem CID 142989852) has the molecular formula C23H21N3OS3 and a molecular weight of 451.64 g/mol. Its IUPAC name is (2E,4Z)-5-ethylsulfanyl-5-[6-methyl-3-[(1Z)-1-sulfanylbuta-1,3-dienyl]-2-thiophen-2-ylpyrido[2,3-b]pyrazin-7-yl]penta-2,4-dienal.
| Compound Name | (2E,4Z)-5-ethylsulfanyl-5-[6-methyl-3-[(1Z)-1-sulfanylbuta-1,3-dienyl]-2-thiophen-2-ylpyrido[2,3-b]pyrazin-7-yl]penta-2,4-dienal |
|---|---|
| PubChem CID | 142989852 |
| Molecular Formula | C23H21N3OS3 |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | (2E,4Z)-5-ethylsulfanyl-5-[6-methyl-3-[(1Z)-1-sulfanylbuta-1,3-dienyl]-2-thiophen-2-ylpyrido[2,3-b]pyrazin-7-yl]penta-2,4-dienal |
| SMILES | C=C/C=C(\S)c1nc2nc(C)c(/C(=C/C=C/C=O)SCC)cc2nc1-c1cccs1 |
| InChI | InChI=1S/C23H21N3OS3/c1-4-9-18(28)21-22(20-11-8-13-30-20)25-17-14-16(15(3)24-23(17)26-21)19(29-5-2)10-6-7-12-27/h4,6-14,28H,1,5H2,2-3H3/b7-6+,18-9-,19-10- |
| InChIKey | BHBRBNVYIKPJRZ-BFRPHHQYSA-N |
| XLogP | 6.37 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|