C26H28N4O2S — CID 101445008
4-[3-[4-(3-ethyl-2-thiophen-2-ylpyrido[2,3-b]pyrazin-7-yl)phenoxy]propyl]morpholine (PubChem CID 101445008) has the molecular formula C26H28N4O2S and a molecular weight of 460.60 g/mol. Its IUPAC name is 4-[3-[4-(3-ethyl-2-thiophen-2-ylpyrido[2,3-b]pyrazin-7-yl)phenoxy]propyl]morpholine.
| Compound Name | 4-[3-[4-(3-ethyl-2-thiophen-2-ylpyrido[2,3-b]pyrazin-7-yl)phenoxy]propyl]morpholine |
|---|---|
| PubChem CID | 101445008 |
| Molecular Formula | C26H28N4O2S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 4-[3-[4-(3-ethyl-2-thiophen-2-ylpyrido[2,3-b]pyrazin-7-yl)phenoxy]propyl]morpholine |
| SMILES | CCc1nc2ncc(-c3ccc(OCCCN4CCOCC4)cc3)cc2nc1-c1cccs1 |
| InChI | InChI=1S/C26H28N4O2S/c1-2-22-25(24-5-3-16-33-24)28-23-17-20(18-27-26(23)29-22)19-6-8-21(9-7-19)32-13-4-10-30-11-14-31-15-12-30/h3,5-9,16-18H,2,4,10-15H2,1H3 |
| InChIKey | IUMPIHVEGXVAQJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|