C28H31N5O3S — CID 101445010
4-[7-[4-(3-morpholin-4-ylpropoxy)phenyl]-2-thiophen-2-ylpyrido[2,3-b]pyrazin-3-yl]morpholine (PubChem CID 101445010) has the molecular formula C28H31N5O3S and a molecular weight of 517.66 g/mol. Its IUPAC name is 4-[7-[4-(3-morpholin-4-ylpropoxy)phenyl]-2-thiophen-2-ylpyrido[2,3-b]pyrazin-3-yl]morpholine.
| Compound Name | 4-[7-[4-(3-morpholin-4-ylpropoxy)phenyl]-2-thiophen-2-ylpyrido[2,3-b]pyrazin-3-yl]morpholine |
|---|---|
| PubChem CID | 101445010 |
| Molecular Formula | C28H31N5O3S |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | 4-[7-[4-(3-morpholin-4-ylpropoxy)phenyl]-2-thiophen-2-ylpyrido[2,3-b]pyrazin-3-yl]morpholine |
| SMILES | c1csc(-c2nc3cc(-c4ccc(OCCCN5CCOCC5)cc4)cnc3nc2N2CCOCC2)c1 |
| InChI | InChI=1S/C28H31N5O3S/c1-3-25(37-18-1)26-28(33-11-16-35-17-12-33)31-27-24(30-26)19-22(20-29-27)21-4-6-23(7-5-21)36-13-2-8-32-9-14-34-15-10-32/h1,3-7,18-20H,2,8-17H2 |
| InChIKey | UPYCHYIMYWGXIZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 72.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|