C17H24ClN3O2S — CID 126697388
[2-[4-(3-morpholin-4-ylpropoxy)phenyl]-1,3-thiazol-5-yl]methanamine;hydrochloride (PubChem CID 126697388) has the molecular formula C17H24ClN3O2S and a molecular weight of 369.92 g/mol. Its IUPAC name is [2-[4-(3-morpholin-4-ylpropoxy)phenyl]-1,3-thiazol-5-yl]methanamine;hydrochloride.
| Compound Name | [2-[4-(3-morpholin-4-ylpropoxy)phenyl]-1,3-thiazol-5-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 126697388 |
| Molecular Formula | C17H24ClN3O2S |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | [2-[4-(3-morpholin-4-ylpropoxy)phenyl]-1,3-thiazol-5-yl]methanamine;hydrochloride |
| SMILES | Cl.NCc1cnc(-c2ccc(OCCCN3CCOCC3)cc2)s1 |
| InChI | InChI=1S/C17H23N3O2S.ClH/c18-12-16-13-19-17(23-16)14-2-4-15(5-3-14)22-9-1-6-20-7-10-21-11-8-20;/h2-5,13H,1,6-12,18H2;1H |
| InChIKey | FIULYQFMPYJHQU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|