C19H25N3O3S — CID 142744476
methyl (2S)-1-[3-[4-[5-(aminomethyl)-1,3-thiazol-2-yl]phenoxy]propyl]pyrrolidine-2-carboxylate (PubChem CID 142744476) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is methyl (2S)-1-[3-[4-[5-(aminomethyl)-1,3-thiazol-2-yl]phenoxy]propyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[3-[4-[5-(aminomethyl)-1,3-thiazol-2-yl]phenoxy]propyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 142744476 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | methyl (2S)-1-[3-[4-[5-(aminomethyl)-1,3-thiazol-2-yl]phenoxy]propyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1CCCOc1ccc(-c2ncc(CN)s2)cc1 |
| InChI | InChI=1S/C19H25N3O3S/c1-24-19(23)17-4-2-9-22(17)10-3-11-25-15-7-5-14(6-8-15)18-21-13-16(12-20)26-18/h5-8,13,17H,2-4,9-12,20H2,1H3/t17-/m0/s1 |
| InChIKey | XNURMEMACYGVIS-KRWDZBQOSA-N |
| XLogP | 2.68 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|