C8H5Br3S2 — CID 158267440
2-bromothiophene;2,5-dibromothiophene (PubChem CID 158267440) has the molecular formula C8H5Br3S2 and a molecular weight of 404.97 g/mol. Its IUPAC name is 2-bromothiophene;2,5-dibromothiophene.
| Compound Name | 2-bromothiophene;2,5-dibromothiophene |
|---|---|
| PubChem CID | 158267440 |
| Molecular Formula | C8H5Br3S2 |
| Molecular Weight | 404.97 g/mol |
| Exact Mass | 401.74 |
| IUPAC Name | 2-bromothiophene;2,5-dibromothiophene |
| SMILES | Brc1ccc(Br)s1.Brc1cccs1 |
| InChI | InChI=1S/C4H2Br2S.C4H3BrS/c5-3-1-2-4(6)7-3;5-4-2-1-3-6-4/h1-2H;1-3H |
| InChIKey | GIPVHODGOGODNF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.97 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |