About 2-bromothiophene;N-dithiophen-2-ylphosphanyl-N-methylmethanamine;methane
2-bromothiophene;N-dithiophen-2-ylphosphanyl-N-methylmethanamine;methane (PubChem CID 158437013) has the molecular formula C16H23BrNPS3
and a molecular weight of 436.45 g/mol. Its IUPAC name is 2-bromothiophene;N-dithiophen-2-ylphosphanyl-N-methylmethanamine;methane.
Molecular Properties
| Compound Name | 2-bromothiophene;N-dithiophen-2-ylphosphanyl-N-methylmethanamine;methane |
| PubChem CID | 158437013 |
| Molecular Formula | C16H23BrNPS3 |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 434.99 |
| IUPAC Name | 2-bromothiophene;N-dithiophen-2-ylphosphanyl-N-methylmethanamine;methane |
| SMILES | Brc1cccs1.C.C.CN(C)P(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C10H12NPS2.C4H3BrS.2CH4/c1-11(2)12(9-5-3-7-13-9)10-6-4-8-14-10;5-4-2-1-3-6-4;;/h3-8H,1-2H3;1-3H;2*1H4 |
| InChIKey | HCIVDCOGINCYRG-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-bromothiophene;N-dithiophen-2-ylphosphanyl-N-methylmethanamine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromothiophene;N-dithiophen-2-ylphosphanyl-N-methylmethanamine;methane?
The IUPAC name of 2-bromothiophene;N-dithiophen-2-ylphosphanyl-N-methylmethanamine;methane (CID 158437013) is 2-bromothiophene;N-dithiophen-2-ylphosphanyl-N-methylmethanamine;methane.
What is the SMILES notation for 2-bromothiophene;N-dithiophen-2-ylphosphanyl-N-methylmethanamine;methane?
The canonical SMILES for 2-bromothiophene;N-dithiophen-2-ylphosphanyl-N-methylmethanamine;methane is Brc1cccs1.C.C.CN(C)P(c1cccs1)c1cccs1.
What is the InChIKey of 2-bromothiophene;N-dithiophen-2-ylphosphanyl-N-methylmethanamine;methane?
The InChIKey is HCIVDCOGINCYRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12NPS2.C4H3BrS.2CH4/c1-11(2)12(9-5-3-7-13-9)10-6-4-8-14-10;5-4-2-1-3-6-4;;/h3-8H,1-2H3;1-3H;2*1H4.
What are the key properties of 2-bromothiophene;N-dithiophen-2-ylphosphanyl-N-methylmethanamine;methane?
2-bromothiophene;N-dithiophen-2-ylphosphanyl-N-methylmethanamine;methane has a molecular weight of 436.45 g/mol, XLogP of 6.50, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromothiophene;N-dithiophen-2-ylphosphanyl-N-methylmethanamine;methane is sourced from PubChem (CID 158437013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).