C48H55BrN2S2 — CID 159176687
2-bromothiophene;3,6-ditert-butyl-9H-carbazole;3,6-ditert-butyl-9-thiophen-2-ylcarbazole (PubChem CID 159176687) has the molecular formula C48H55BrN2S2 and a molecular weight of 804.02 g/mol. Its IUPAC name is 2-bromothiophene;3,6-ditert-butyl-9H-carbazole;3,6-ditert-butyl-9-thiophen-2-ylcarbazole.
| Compound Name | 2-bromothiophene;3,6-ditert-butyl-9H-carbazole;3,6-ditert-butyl-9-thiophen-2-ylcarbazole |
|---|---|
| PubChem CID | 159176687 |
| Molecular Formula | C48H55BrN2S2 |
| Molecular Weight | 804.02 g/mol |
| Exact Mass | 802.30 |
| IUPAC Name | 2-bromothiophene;3,6-ditert-butyl-9H-carbazole;3,6-ditert-butyl-9-thiophen-2-ylcarbazole |
| SMILES | Brc1cccs1.CC(C)(C)c1ccc2[nH]c3ccc(C(C)(C)C)cc3c2c1.CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cccs1 |
| InChI | InChI=1S/C24H27NS.C20H25N.C4H3BrS/c1-23(2,3)16-9-11-20-18(14-16)19-15-17(24(4,5)6)10-12-21(19)25(20)22-8-7-13-26-22;1-19(2,3)13-7-9-17-15(11-13)16-12-14(20(4,5)6)8-10-18(16)21-17;5-4-2-1-3-6-4/h7-15H,1-6H3;7-12,21H,1-6H3;1-3H |
| InChIKey | KMJGFDFCXUDFLA-UHFFFAOYSA-N |
| XLogP | 15.87 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.02 |
| LogP ≤ 5 | 15.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |