C30H26N2 — CID 144609045
3-tert-butyl-5-(4-phenylphenyl)-10H-indolo[3,2-b]indole (PubChem CID 144609045) has the molecular formula C30H26N2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 3-tert-butyl-5-(4-phenylphenyl)-10H-indolo[3,2-b]indole.
| Compound Name | 3-tert-butyl-5-(4-phenylphenyl)-10H-indolo[3,2-b]indole |
|---|---|
| PubChem CID | 144609045 |
| Molecular Formula | C30H26N2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 3-tert-butyl-5-(4-phenylphenyl)-10H-indolo[3,2-b]indole |
| SMILES | CC(C)(C)c1ccc2[nH]c3c4ccccc4n(-c4ccc(-c5ccccc5)cc4)c3c2c1 |
| InChI | InChI=1S/C30H26N2/c1-30(2,3)22-15-18-26-25(19-22)29-28(31-26)24-11-7-8-12-27(24)32(29)23-16-13-21(14-17-23)20-9-5-4-6-10-20/h4-19,31H,1-3H3 |
| InChIKey | QCFXVRQPYQKMIT-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |