C72H83Br2N5O2 — CID 160823727
[2,6-bis(3,6-ditert-butylcarbazol-9-yl)-4-pyridinyl]methanol;(2,6-dibromo-4-pyridinyl)methanol;3,6-ditert-butyl-9H-carbazole (PubChem CID 160823727) has the molecular formula C72H83Br2N5O2 and a molecular weight of 1210.30 g/mol. Its IUPAC name is [2,6-bis(3,6-ditert-butylcarbazol-9-yl)-4-pyridinyl]methanol;(2,6-dibromo-4-pyridinyl)methanol;3,6-ditert-butyl-9H-carbazole.
| Compound Name | [2,6-bis(3,6-ditert-butylcarbazol-9-yl)-4-pyridinyl]methanol;(2,6-dibromo-4-pyridinyl)methanol;3,6-ditert-butyl-9H-carbazole |
|---|---|
| PubChem CID | 160823727 |
| Molecular Formula | C72H83Br2N5O2 |
| Molecular Weight | 1210.30 g/mol |
| Exact Mass | 1207.49 |
| IUPAC Name | [2,6-bis(3,6-ditert-butylcarbazol-9-yl)-4-pyridinyl]methanol;(2,6-dibromo-4-pyridinyl)methanol;3,6-ditert-butyl-9H-carbazole |
| SMILES | CC(C)(C)c1ccc2[nH]c3ccc(C(C)(C)C)cc3c2c1.CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cc(CO)cc(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)n1.OCc1cc(Br)nc(Br)c1 |
| InChI | InChI=1S/C46H53N3O.C20H25N.C6H5Br2NO/c1-43(2,3)29-13-17-37-33(23-29)34-24-30(44(4,5)6)14-18-38(34)48(37)41-21-28(27-50)22-42(47-41)49-39-19-15-31(45(7,8)9)25-35(39)36-26-32(46(10,11)12)16-20-40(36)49;1-19(2,3)13-7-9-17-15(11-13)16-12-14(20(4,5)6)8-10-18(16)21-17;7-5-1-4(3-10)2-6(8)9-5/h13-26,50H,27H2,1-12H3;7-12,21H,1-6H3;1-2,10H,3H2 |
| InChIKey | SFWNSRKKWNLXKF-UHFFFAOYSA-N |
| XLogP | 19.97 |
| TPSA | 91.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1210.30 |
| LogP ≤ 5 | 19.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|