About 2H-silole;2-thiophen-2-ylthiophene
2H-silole;2-thiophen-2-ylthiophene (PubChem CID 174687836) has the molecular formula C12H12S2Si
and a molecular weight of 248.45 g/mol. Its IUPAC name is 2H-silole;2-thiophen-2-ylthiophene.
Molecular Properties
| Compound Name | 2H-silole;2-thiophen-2-ylthiophene |
| PubChem CID | 174687836 |
| Molecular Formula | C12H12S2Si |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 2H-silole;2-thiophen-2-ylthiophene |
| SMILES | C1=CC[SiH]=C1.c1csc(-c2cccs2)c1 |
| InChI | InChI=1S/C8H6S2.C4H6Si/c1-3-7(9-5-1)8-4-2-6-10-8;1-2-4-5-3-1/h1-6H;1-3,5H,4H2 |
| InChIKey | UBBKIQOLOREEQQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2H-silole;2-thiophen-2-ylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-silole;2-thiophen-2-ylthiophene?
The IUPAC name of 2H-silole;2-thiophen-2-ylthiophene (CID 174687836) is 2H-silole;2-thiophen-2-ylthiophene.
What is the SMILES notation for 2H-silole;2-thiophen-2-ylthiophene?
The canonical SMILES for 2H-silole;2-thiophen-2-ylthiophene is C1=CC[SiH]=C1.c1csc(-c2cccs2)c1.
What is the InChIKey of 2H-silole;2-thiophen-2-ylthiophene?
The InChIKey is UBBKIQOLOREEQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6S2.C4H6Si/c1-3-7(9-5-1)8-4-2-6-10-8;1-2-4-5-3-1/h1-6H;1-3,5H,4H2.
What are the key properties of 2H-silole;2-thiophen-2-ylthiophene?
2H-silole;2-thiophen-2-ylthiophene has a molecular weight of 248.45 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-silole;2-thiophen-2-ylthiophene is sourced from PubChem (CID 174687836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).