C16H12S3 — CID 100936208
1,3-dithiophen-2-yl-3a,7a-dihydro-2-benzothiophene (PubChem CID 100936208) has the molecular formula C16H12S3 and a molecular weight of 300.47 g/mol. Its IUPAC name is 1,3-dithiophen-2-yl-3a,7a-dihydro-2-benzothiophene.
| Compound Name | 1,3-dithiophen-2-yl-3a,7a-dihydro-2-benzothiophene |
|---|---|
| PubChem CID | 100936208 |
| Molecular Formula | C16H12S3 |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 1,3-dithiophen-2-yl-3a,7a-dihydro-2-benzothiophene |
| SMILES | C1=CC2C(c3cccs3)=S=C(c3cccs3)C2C=C1 |
| InChI | InChI=1S/C16H12S3/c1-2-6-12-11(5-1)15(13-7-3-9-17-13)19-16(12)14-8-4-10-18-14/h1-12H |
| InChIKey | JNLIIYUMJBOVKZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|