C12H8N2S4 — CID 100816758
(3aR,6aR)-2,5-dithiophen-2-yl-3a,6a-dihydro-[1,3]thiazolo[5,4-d][1,3]thiazole (PubChem CID 100816758) has the molecular formula C12H8N2S4 and a molecular weight of 308.48 g/mol. Its IUPAC name is (3aR,6aR)-2,5-dithiophen-2-yl-3a,6a-dihydro-[1,3]thiazolo[5,4-d][1,3]thiazole.
| Compound Name | (3aR,6aR)-2,5-dithiophen-2-yl-3a,6a-dihydro-[1,3]thiazolo[5,4-d][1,3]thiazole |
|---|---|
| PubChem CID | 100816758 |
| Molecular Formula | C12H8N2S4 |
| Molecular Weight | 308.48 g/mol |
| Exact Mass | 307.96 |
| IUPAC Name | (3aR,6aR)-2,5-dithiophen-2-yl-3a,6a-dihydro-[1,3]thiazolo[5,4-d][1,3]thiazole |
| SMILES | c1csc(C2=N[C@@H]3SC(c4cccs4)=N[C@@H]3S2)c1 |
| InChI | InChI=1S/C12H8N2S4/c1-3-7(15-5-1)9-13-11-12(17-9)14-10(18-11)8-4-2-6-16-8/h1-6,11-12H/t11-,12-/m1/s1 |
| InChIKey | OWGONMGDVRAGSN-VXGBXAGGSA-N |
| XLogP | 4.15 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |