About 6-hydroxy-3-thiophen-2-yl-1,4,2-oxathiazin-5-one
6-hydroxy-3-thiophen-2-yl-1,4,2-oxathiazin-5-one (PubChem CID 90689330) has the molecular formula C7H5NO3S2
and a molecular weight of 215.25 g/mol. Its IUPAC name is 6-hydroxy-3-thiophen-2-yl-1,4,2-oxathiazin-5-one.
Molecular Properties
| Compound Name | 6-hydroxy-3-thiophen-2-yl-1,4,2-oxathiazin-5-one |
| PubChem CID | 90689330 |
| Molecular Formula | C7H5NO3S2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 214.97 |
| IUPAC Name | 6-hydroxy-3-thiophen-2-yl-1,4,2-oxathiazin-5-one |
| SMILES | O=C1SC(c2cccs2)=NOC1O |
| InChI | InChI=1S/C7H5NO3S2/c9-6-7(10)13-5(8-11-6)4-2-1-3-12-4/h1-3,6,9H |
| InChIKey | XJSLMBIZFITYEO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-3-thiophen-2-yl-1,4,2-oxathiazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-3-thiophen-2-yl-1,4,2-oxathiazin-5-one?
The IUPAC name of 6-hydroxy-3-thiophen-2-yl-1,4,2-oxathiazin-5-one (CID 90689330) is 6-hydroxy-3-thiophen-2-yl-1,4,2-oxathiazin-5-one.
What is the SMILES notation for 6-hydroxy-3-thiophen-2-yl-1,4,2-oxathiazin-5-one?
The canonical SMILES for 6-hydroxy-3-thiophen-2-yl-1,4,2-oxathiazin-5-one is O=C1SC(c2cccs2)=NOC1O.
What is the InChIKey of 6-hydroxy-3-thiophen-2-yl-1,4,2-oxathiazin-5-one?
The InChIKey is XJSLMBIZFITYEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3S2/c9-6-7(10)13-5(8-11-6)4-2-1-3-12-4/h1-3,6,9H.
What are the key properties of 6-hydroxy-3-thiophen-2-yl-1,4,2-oxathiazin-5-one?
6-hydroxy-3-thiophen-2-yl-1,4,2-oxathiazin-5-one has a molecular weight of 215.25 g/mol, XLogP of 1.02, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-3-thiophen-2-yl-1,4,2-oxathiazin-5-one is sourced from PubChem (CID 90689330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).