C7H5NO3S2 — CID 90689330
6-hydroxy-3-thiophen-2-yl-1,4,2-oxathiazin-5-one (PubChem CID 90689330) has the molecular formula C7H5NO3S2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 6-hydroxy-3-thiophen-2-yl-1,4,2-oxathiazin-5-one.
| Compound Name | 6-hydroxy-3-thiophen-2-yl-1,4,2-oxathiazin-5-one |
|---|---|
| PubChem CID | 90689330 |
| Molecular Formula | C7H5NO3S2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 214.97 |
| IUPAC Name | 6-hydroxy-3-thiophen-2-yl-1,4,2-oxathiazin-5-one |
| SMILES | O=C1SC(c2cccs2)=NOC1O |
| InChI | InChI=1S/C7H5NO3S2/c9-6-7(10)13-5(8-11-6)4-2-1-3-12-4/h1-3,6,9H |
| InChIKey | XJSLMBIZFITYEO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|