C8H9N3O2S — CID 1485147
(5R)-3-thiophen-2-yl-4,5-dihydro-1,2-oxazole-5-carbohydrazide (PubChem CID 1485147) has the molecular formula C8H9N3O2S and a molecular weight of 211.25 g/mol. Its IUPAC name is (5R)-3-thiophen-2-yl-4,5-dihydro-1,2-oxazole-5-carbohydrazide.
| Compound Name | (5R)-3-thiophen-2-yl-4,5-dihydro-1,2-oxazole-5-carbohydrazide |
|---|---|
| PubChem CID | 1485147 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | (5R)-3-thiophen-2-yl-4,5-dihydro-1,2-oxazole-5-carbohydrazide |
| SMILES | NNC(=O)[C@H]1CC(c2cccs2)=NO1 |
| InChI | InChI=1S/C8H9N3O2S/c9-10-8(12)6-4-5(11-13-6)7-2-1-3-14-7/h1-3,6H,4,9H2,(H,10,12)/t6-/m1/s1 |
| InChIKey | FAKXLBGYKKNIBK-ZCFIWIBFSA-N |
| XLogP | 0.23 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|