C10H7N3OS2 — CID 78145825
2-amino-5-thiophen-2-yl-4aH-thieno[2,3-d]pyrimidin-4-one (PubChem CID 78145825) has the molecular formula C10H7N3OS2 and a molecular weight of 249.32 g/mol. Its IUPAC name is 2-amino-5-thiophen-2-yl-4aH-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-5-thiophen-2-yl-4aH-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 78145825 |
| Molecular Formula | C10H7N3OS2 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 2-amino-5-thiophen-2-yl-4aH-thieno[2,3-d]pyrimidin-4-one |
| SMILES | NC1=NC(=O)C2C(c3cccs3)=CSC2=N1 |
| InChI | InChI=1S/C10H7N3OS2/c11-10-12-8(14)7-5(4-16-9(7)13-10)6-2-1-3-15-6/h1-4,7H,(H2,11,12,14) |
| InChIKey | AKYGZYULYOMNFI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |