C11H8N2O2S2 — CID 57390260
5-(5-thiophen-2-ylthiophen-2-yl)imidazolidine-2,4-dione (PubChem CID 57390260) has the molecular formula C11H8N2O2S2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 5-(5-thiophen-2-ylthiophen-2-yl)imidazolidine-2,4-dione.
| Compound Name | 5-(5-thiophen-2-ylthiophen-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 57390260 |
| Molecular Formula | C11H8N2O2S2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 5-(5-thiophen-2-ylthiophen-2-yl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2ccc(-c3cccs3)s2)N1 |
| InChI | InChI=1S/C11H8N2O2S2/c14-10-9(12-11(15)13-10)8-4-3-7(17-8)6-2-1-5-16-6/h1-5,9H,(H2,12,13,14,15) |
| InChIKey | GVQKGOLOKBVSKC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|