C8H8N2O2S — CID 98150794
(5R)-5-(3-methylthiophen-2-yl)imidazolidine-2,4-dione (PubChem CID 98150794) has the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. Its IUPAC name is (5R)-5-(3-methylthiophen-2-yl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(3-methylthiophen-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 98150794 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | (5R)-5-(3-methylthiophen-2-yl)imidazolidine-2,4-dione |
| SMILES | Cc1ccsc1[C@@H]1NC(=O)NC1=O |
| InChI | InChI=1S/C8H8N2O2S/c1-4-2-3-13-6(4)5-7(11)10-8(12)9-5/h2-3,5H,1H3,(H2,9,10,11,12)/t5-/m0/s1 |
| InChIKey | QQIAWYFWXYTOMK-YFKPBYRVSA-N |
| XLogP | 0.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|