C8H8N2OS2 — CID 130581585
5-(2-methylthiophen-3-yl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 130581585) has the molecular formula C8H8N2OS2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 5-(2-methylthiophen-3-yl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-(2-methylthiophen-3-yl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 130581585 |
| Molecular Formula | C8H8N2OS2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | 5-(2-methylthiophen-3-yl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1sccc1C1NC(=S)NC1=O |
| InChI | InChI=1S/C8H8N2OS2/c1-4-5(2-3-13-4)6-7(11)10-8(12)9-6/h2-3,6H,1H3,(H2,9,10,11,12) |
| InChIKey | PGMWEPINQHLTCV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|