C6H12N2OS — CID 142805949
ethane;5-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 142805949) has the molecular formula C6H12N2OS and a molecular weight of 160.24 g/mol. Its IUPAC name is ethane;5-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | ethane;5-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 142805949 |
| Molecular Formula | C6H12N2OS |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | ethane;5-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CC.CC1NC(=S)NC1=O |
| InChI | InChI=1S/C4H6N2OS.C2H6/c1-2-3(7)6-4(8)5-2;1-2/h2H,1H3,(H2,5,6,7,8);1-2H3 |
| InChIKey | AHUVLJBSWRPOCD-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|