C4H5NO2S — CID 45086589
(4S)-4-methyl-2-sulfanylidene-1,3-oxazolidin-5-one (PubChem CID 45086589) has the molecular formula C4H5NO2S and a molecular weight of 131.16 g/mol. Its IUPAC name is (4S)-4-methyl-2-sulfanylidene-1,3-oxazolidin-5-one.
| Compound Name | (4S)-4-methyl-2-sulfanylidene-1,3-oxazolidin-5-one |
|---|---|
| PubChem CID | 45086589 |
| Molecular Formula | C4H5NO2S |
| Molecular Weight | 131.16 g/mol |
| Exact Mass | 131.00 |
| IUPAC Name | (4S)-4-methyl-2-sulfanylidene-1,3-oxazolidin-5-one |
| SMILES | C[C@@H]1NC(=S)OC1=O |
| InChI | InChI=1S/C4H5NO2S/c1-2-3(6)7-4(8)5-2/h2H,1H3,(H,5,8)/t2-/m0/s1 |
| InChIKey | XICJEVJKZYSURA-REOHCLBHSA-N |
| XLogP | -0.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.16 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|