C6H7NO3 — CID 98077108
(2Z)-2-[(4R)-4-methyl-5-oxo-1,3-oxazolidin-2-ylidene]acetaldehyde (PubChem CID 98077108) has the molecular formula C6H7NO3 and a molecular weight of 141.13 g/mol. Its IUPAC name is (2Z)-2-[(4R)-4-methyl-5-oxo-1,3-oxazolidin-2-ylidene]acetaldehyde.
| Compound Name | (2Z)-2-[(4R)-4-methyl-5-oxo-1,3-oxazolidin-2-ylidene]acetaldehyde |
|---|---|
| PubChem CID | 98077108 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | (2Z)-2-[(4R)-4-methyl-5-oxo-1,3-oxazolidin-2-ylidene]acetaldehyde |
| SMILES | C[C@H]1N/C(=C/C=O)OC1=O |
| InChI | InChI=1S/C6H7NO3/c1-4-6(9)10-5(7-4)2-3-8/h2-4,7H,1H3/b5-2-/t4-/m1/s1 |
| InChIKey | KBLSMVFJNOSURV-PLSQTASKSA-N |
| XLogP | -0.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|