C5H6N2O2S — CID 87931135
5-acetyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 87931135) has the molecular formula C5H6N2O2S and a molecular weight of 158.18 g/mol. Its IUPAC name is 5-acetyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-acetyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 87931135 |
| Molecular Formula | C5H6N2O2S |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.01 |
| IUPAC Name | 5-acetyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CC(=O)C1NC(=S)NC1=O |
| InChI | InChI=1S/C5H6N2O2S/c1-2(8)3-4(9)7-5(10)6-3/h3H,1H3,(H2,6,7,9,10) |
| InChIKey | VNJQOXNLRUSGMN-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|