C9H11NO2S — CID 130665628
(4R)-4-(3-methylthiophen-2-yl)-1,3-oxazinan-2-one (PubChem CID 130665628) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is (4R)-4-(3-methylthiophen-2-yl)-1,3-oxazinan-2-one.
| Compound Name | (4R)-4-(3-methylthiophen-2-yl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 130665628 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | (4R)-4-(3-methylthiophen-2-yl)-1,3-oxazinan-2-one |
| SMILES | Cc1ccsc1[C@H]1CCOC(=O)N1 |
| InChI | InChI=1S/C9H11NO2S/c1-6-3-5-13-8(6)7-2-4-12-9(11)10-7/h3,5,7H,2,4H2,1H3,(H,10,11)/t7-/m1/s1 |
| InChIKey | QBTMJQXXSWVFMF-SSDOTTSWSA-N |
| XLogP | 2.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |