C11H11F2NO2 — CID 171185840
(4S)-4-(2,6-difluoro-3-methylphenyl)-1,3-oxazinan-2-one (PubChem CID 171185840) has the molecular formula C11H11F2NO2 and a molecular weight of 227.21 g/mol. Its IUPAC name is (4S)-4-(2,6-difluoro-3-methylphenyl)-1,3-oxazinan-2-one.
| Compound Name | (4S)-4-(2,6-difluoro-3-methylphenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171185840 |
| Molecular Formula | C11H11F2NO2 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | (4S)-4-(2,6-difluoro-3-methylphenyl)-1,3-oxazinan-2-one |
| SMILES | Cc1ccc(F)c([C@@H]2CCOC(=O)N2)c1F |
| InChI | InChI=1S/C11H11F2NO2/c1-6-2-3-7(12)9(10(6)13)8-4-5-16-11(15)14-8/h2-3,8H,4-5H2,1H3,(H,14,15)/t8-/m0/s1 |
| InChIKey | YAUUWKXKBRBMQY-QMMMGPOBSA-N |
| XLogP | 2.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |