C7H6ClNO2S — CID 130148770
4-(3-chlorothiophen-2-yl)-1,3-oxazolidin-2-one (PubChem CID 130148770) has the molecular formula C7H6ClNO2S and a molecular weight of 203.65 g/mol. Its IUPAC name is 4-(3-chlorothiophen-2-yl)-1,3-oxazolidin-2-one.
| Compound Name | 4-(3-chlorothiophen-2-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 130148770 |
| Molecular Formula | C7H6ClNO2S |
| Molecular Weight | 203.65 g/mol |
| Exact Mass | 202.98 |
| IUPAC Name | 4-(3-chlorothiophen-2-yl)-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(c2sccc2Cl)CO1 |
| InChI | InChI=1S/C7H6ClNO2S/c8-4-1-2-12-6(4)5-3-11-7(10)9-5/h1-2,5H,3H2,(H,9,10) |
| InChIKey | AXURHLLOKHRIKC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.65 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |