C7H6ClNO3 — CID 130692441
(4S)-4-(5-chlorofuran-2-yl)-1,3-oxazolidin-2-one (PubChem CID 130692441) has the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. Its IUPAC name is (4S)-4-(5-chlorofuran-2-yl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-(5-chlorofuran-2-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 130692441 |
| Molecular Formula | C7H6ClNO3 |
| Molecular Weight | 187.58 g/mol |
| Exact Mass | 187.00 |
| IUPAC Name | (4S)-4-(5-chlorofuran-2-yl)-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@H](c2ccc(Cl)o2)CO1 |
| InChI | InChI=1S/C7H6ClNO3/c8-6-2-1-5(12-6)4-3-11-7(10)9-4/h1-2,4H,3H2,(H,9,10)/t4-/m0/s1 |
| InChIKey | CUKAWGVQLNUEFK-BYPYZUCNSA-N |
| XLogP | 1.71 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.58 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |