C9H10ClNO3 — CID 130955627
(2S,5S)-5-(5-chlorofuran-2-yl)pyrrolidine-2-carboxylic acid (PubChem CID 130955627) has the molecular formula C9H10ClNO3 and a molecular weight of 215.64 g/mol. Its IUPAC name is (2S,5S)-5-(5-chlorofuran-2-yl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,5S)-5-(5-chlorofuran-2-yl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 130955627 |
| Molecular Formula | C9H10ClNO3 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | (2S,5S)-5-(5-chlorofuran-2-yl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC[C@@H](c2ccc(Cl)o2)N1 |
| InChI | InChI=1S/C9H10ClNO3/c10-8-4-3-7(14-8)5-1-2-6(11-5)9(12)13/h3-6,11H,1-2H2,(H,12,13)/t5-,6-/m0/s1 |
| InChIKey | DHKCVMNGZJPHFW-WDSKDSINSA-N |
| XLogP | 1.81 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |