C12H13Cl2NO3 — CID 175831393
5-(2,3-dichloro-6-methoxyphenyl)pyrrolidine-2-carboxylic acid (PubChem CID 175831393) has the molecular formula C12H13Cl2NO3 and a molecular weight of 290.15 g/mol. Its IUPAC name is 5-(2,3-dichloro-6-methoxyphenyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 5-(2,3-dichloro-6-methoxyphenyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175831393 |
| Molecular Formula | C12H13Cl2NO3 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 5-(2,3-dichloro-6-methoxyphenyl)pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(Cl)c(Cl)c1C1CCC(C(=O)O)N1 |
| InChI | InChI=1S/C12H13Cl2NO3/c1-18-9-5-2-6(13)11(14)10(9)7-3-4-8(15-7)12(16)17/h2,5,7-8,15H,3-4H2,1H3,(H,16,17) |
| InChIKey | LFDDXAICRADEAI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |