C22H26N2OS — CID 1476855
(6R)-2,3,9,9-tetramethyl-6-(3-methylthiophen-2-yl)-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 1476855) has the molecular formula C22H26N2OS and a molecular weight of 366.53 g/mol. Its IUPAC name is (6R)-2,3,9,9-tetramethyl-6-(3-methylthiophen-2-yl)-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R)-2,3,9,9-tetramethyl-6-(3-methylthiophen-2-yl)-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 1476855 |
| Molecular Formula | C22H26N2OS |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (6R)-2,3,9,9-tetramethyl-6-(3-methylthiophen-2-yl)-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | Cc1cc2c(cc1C)N[C@@H](c1sccc1C)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C22H26N2OS/c1-12-6-7-26-21(12)20-19-17(10-22(4,5)11-18(19)25)23-15-8-13(2)14(3)9-16(15)24-20/h6-9,20,23-24H,10-11H2,1-5H3/t20-/m1/s1 |
| InChIKey | RFGUYZOZWNSWSH-HXUWFJFHSA-N |
| XLogP | 5.90 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |