C24H25F3N2O — CID 7084279
(6S)-2,3,9,9-tetramethyl-6-[2-(trifluoromethyl)phenyl]-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 7084279) has the molecular formula C24H25F3N2O and a molecular weight of 414.47 g/mol. Its IUPAC name is (6S)-2,3,9,9-tetramethyl-6-[2-(trifluoromethyl)phenyl]-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6S)-2,3,9,9-tetramethyl-6-[2-(trifluoromethyl)phenyl]-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 7084279 |
| Molecular Formula | C24H25F3N2O |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (6S)-2,3,9,9-tetramethyl-6-[2-(trifluoromethyl)phenyl]-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | Cc1cc2c(cc1C)N[C@@H](c1ccccc1C(F)(F)F)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C24H25F3N2O/c1-13-9-17-18(10-14(13)2)29-22(15-7-5-6-8-16(15)24(25,26)27)21-19(28-17)11-23(3,4)12-20(21)30/h5-10,22,28-29H,11-12H2,1-4H3/t22-/m0/s1 |
| InChIKey | BWJAZSVXINQMIY-QFIPXVFZSA-N |
| XLogP | 6.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |