C23H26N2O2 — CID 3152933
6-(2-hydroxyphenyl)-2,3,9,9-tetramethyl-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 3152933) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 6-(2-hydroxyphenyl)-2,3,9,9-tetramethyl-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(2-hydroxyphenyl)-2,3,9,9-tetramethyl-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 3152933 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 6-(2-hydroxyphenyl)-2,3,9,9-tetramethyl-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | Cc1cc2c(cc1C)NC(c1ccccc1O)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C23H26N2O2/c1-13-9-16-17(10-14(13)2)25-22(15-7-5-6-8-19(15)26)21-18(24-16)11-23(3,4)12-20(21)27/h5-10,22,24-26H,11-12H2,1-4H3 |
| InChIKey | BAYSEKHPPOKONC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|