C25H28N2O — CID 1395902
(6R)-2,3,9,9-tetramethyl-6-[(E)-2-phenylethenyl]-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 1395902) has the molecular formula C25H28N2O and a molecular weight of 372.51 g/mol. Its IUPAC name is (6R)-2,3,9,9-tetramethyl-6-[(E)-2-phenylethenyl]-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R)-2,3,9,9-tetramethyl-6-[(E)-2-phenylethenyl]-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 1395902 |
| Molecular Formula | C25H28N2O |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (6R)-2,3,9,9-tetramethyl-6-[(E)-2-phenylethenyl]-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | Cc1cc2c(cc1C)N[C@H](/C=C/c1ccccc1)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C25H28N2O/c1-16-12-20-21(13-17(16)2)27-22-14-25(3,4)15-23(28)24(22)19(26-20)11-10-18-8-6-5-7-9-18/h5-13,19,26-27H,14-15H2,1-4H3/b11-10+/t19-/m1/s1 |
| InChIKey | HVQGBYNCLDGQBV-GNISGLHKSA-N |
| XLogP | 5.87 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |