About 3-oxido-5-thiophen-2-yl-3H-1,3,4-oxadiazol-3-ium-2-one
3-oxido-5-thiophen-2-yl-3H-1,3,4-oxadiazol-3-ium-2-one (PubChem CID 155019240) has the molecular formula C6H4N2O3S
and a molecular weight of 184.18 g/mol. Its IUPAC name is 3-oxido-5-thiophen-2-yl-3H-1,3,4-oxadiazol-3-ium-2-one.
Analyze 3-oxido-5-thiophen-2-yl-3H-1,3,4-oxadiazol-3-ium-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxido-5-thiophen-2-yl-3H-1,3,4-oxadiazol-3-ium-2-one?
The IUPAC name of 3-oxido-5-thiophen-2-yl-3H-1,3,4-oxadiazol-3-ium-2-one (CID 155019240) is 3-oxido-5-thiophen-2-yl-3H-1,3,4-oxadiazol-3-ium-2-one.
What is the SMILES notation for 3-oxido-5-thiophen-2-yl-3H-1,3,4-oxadiazol-3-ium-2-one?
The canonical SMILES for 3-oxido-5-thiophen-2-yl-3H-1,3,4-oxadiazol-3-ium-2-one is O=C1OC(c2cccs2)=N[NH+]1[O-].
What is the InChIKey of 3-oxido-5-thiophen-2-yl-3H-1,3,4-oxadiazol-3-ium-2-one?
The InChIKey is XIGDHUHZQBBRTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O3S/c9-6-8(10)7-5(11-6)4-2-1-3-12-4/h1-3,8H.
What are the key properties of 3-oxido-5-thiophen-2-yl-3H-1,3,4-oxadiazol-3-ium-2-one?
3-oxido-5-thiophen-2-yl-3H-1,3,4-oxadiazol-3-ium-2-one has a molecular weight of 184.18 g/mol, XLogP of -0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxido-5-thiophen-2-yl-3H-1,3,4-oxadiazol-3-ium-2-one is sourced from PubChem (CID 155019240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).