C12H8N2O2S2 — CID 9313062
(4Z)-4-[(2-methyl-1,3-thiazol-4-yl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one (PubChem CID 9313062) has the molecular formula C12H8N2O2S2 and a molecular weight of 276.34 g/mol. Its IUPAC name is (4Z)-4-[(2-methyl-1,3-thiazol-4-yl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(2-methyl-1,3-thiazol-4-yl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 9313062 |
| Molecular Formula | C12H8N2O2S2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | (4Z)-4-[(2-methyl-1,3-thiazol-4-yl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
| SMILES | Cc1nc(/C=C2\N=C(c3cccs3)OC2=O)cs1 |
| InChI | InChI=1S/C12H8N2O2S2/c1-7-13-8(6-18-7)5-9-12(15)16-11(14-9)10-3-2-4-17-10/h2-6H,1H3/b9-5- |
| InChIKey | ZHDWYIKUIJKTKS-UITAMQMPSA-N |
| XLogP | 2.86 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|