C32H18S4 — CID 87695295
2-(1,2,3-trithiophen-2-ylpyren-4-yl)thiophene (PubChem CID 87695295) has the molecular formula C32H18S4 and a molecular weight of 530.76 g/mol. Its IUPAC name is 2-(1,2,3-trithiophen-2-ylpyren-4-yl)thiophene.
| Compound Name | 2-(1,2,3-trithiophen-2-ylpyren-4-yl)thiophene |
|---|---|
| PubChem CID | 87695295 |
| Molecular Formula | C32H18S4 |
| Molecular Weight | 530.76 g/mol |
| Exact Mass | 530.03 |
| IUPAC Name | 2-(1,2,3-trithiophen-2-ylpyren-4-yl)thiophene |
| SMILES | c1csc(-c2c(-c3cccs3)c3ccc4cccc5cc(-c6cccs6)c(c2-c2cccs2)c3c45)c1 |
| InChI | InChI=1S/C32H18S4/c1-6-19-12-13-21-28(24-9-3-15-34-24)31(25-10-4-16-35-25)32(26-11-5-17-36-26)30-22(23-8-2-14-33-23)18-20(7-1)27(19)29(21)30/h1-18H |
| InChIKey | HXLMOKSURUVWMH-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.76 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|