C12H7ClN2O2S — CID 54730141
7-chloro-4-hydroxy-3-thiophen-2-yl-1H-1,5-naphthyridin-2-one (PubChem CID 54730141) has the molecular formula C12H7ClN2O2S and a molecular weight of 278.72 g/mol. Its IUPAC name is 7-chloro-4-hydroxy-3-thiophen-2-yl-1H-1,5-naphthyridin-2-one.
| Compound Name | 7-chloro-4-hydroxy-3-thiophen-2-yl-1H-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 54730141 |
| Molecular Formula | C12H7ClN2O2S |
| Molecular Weight | 278.72 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | 7-chloro-4-hydroxy-3-thiophen-2-yl-1H-1,5-naphthyridin-2-one |
| SMILES | O=c1[nH]c2cc(Cl)cnc2c(O)c1-c1cccs1 |
| InChI | InChI=1S/C12H7ClN2O2S/c13-6-4-7-10(14-5-6)11(16)9(12(17)15-7)8-2-1-3-18-8/h1-5H,(H2,15,16,17) |
| InChIKey | ZFJKBCLEFHRPMV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.72 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |