C22H14ClNO2S — CID 134253189
6-chloro-3-[(E)-3-phenylprop-2-enoyl]-4-thiophen-2-yl-1H-quinolin-2-one (PubChem CID 134253189) has the molecular formula C22H14ClNO2S and a molecular weight of 391.88 g/mol. Its IUPAC name is 6-chloro-3-[(E)-3-phenylprop-2-enoyl]-4-thiophen-2-yl-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-[(E)-3-phenylprop-2-enoyl]-4-thiophen-2-yl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 134253189 |
| Molecular Formula | C22H14ClNO2S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 6-chloro-3-[(E)-3-phenylprop-2-enoyl]-4-thiophen-2-yl-1H-quinolin-2-one |
| SMILES | O=C(/C=C/c1ccccc1)c1c(-c2cccs2)c2cc(Cl)ccc2[nH]c1=O |
| InChI | InChI=1S/C22H14ClNO2S/c23-15-9-10-17-16(13-15)20(19-7-4-12-27-19)21(22(26)24-17)18(25)11-8-14-5-2-1-3-6-14/h1-13H,(H,24,26)/b11-8+ |
| InChIKey | NQFRWNRWINIGEM-DHZHZOJOSA-N |
| XLogP | 5.81 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|