C11H10ClNO6 — CID 54372218
3-(5-chloro-2-nitrophenoxy)-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 54372218) has the molecular formula C11H10ClNO6 and a molecular weight of 287.65 g/mol. Its IUPAC name is 3-(5-chloro-2-nitrophenoxy)-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-(5-chloro-2-nitrophenoxy)-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 54372218 |
| Molecular Formula | C11H10ClNO6 |
| Molecular Weight | 287.65 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 3-(5-chloro-2-nitrophenoxy)-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)Oc1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10ClNO6/c1-11(2,9(14)15)10(16)19-8-5-6(12)3-4-7(8)13(17)18/h3-5H,1-2H3,(H,14,15) |
| InChIKey | UTZPNDVPDVGGNE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.65 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|