C14H15NO6 — CID 101357892
2-[(4,5-dimethoxy-2-nitrophenyl)-hydroxymethyl]cyclopent-2-en-1-one (PubChem CID 101357892) has the molecular formula C14H15NO6 and a molecular weight of 293.28 g/mol. Its IUPAC name is 2-[(4,5-dimethoxy-2-nitrophenyl)-hydroxymethyl]cyclopent-2-en-1-one.
| Compound Name | 2-[(4,5-dimethoxy-2-nitrophenyl)-hydroxymethyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 101357892 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-[(4,5-dimethoxy-2-nitrophenyl)-hydroxymethyl]cyclopent-2-en-1-one |
| SMILES | COc1cc(C(O)C2=CCCC2=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C14H15NO6/c1-20-12-6-9(10(15(18)19)7-13(12)21-2)14(17)8-4-3-5-11(8)16/h4,6-7,14,17H,3,5H2,1-2H3 |
| InChIKey | SQJYAPFZINLONR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|