C13H21NO4 — CID 171263078
4-[(1R,2S)-1-amino-2-hydroxypentyl]-3,5-dimethoxyphenol (PubChem CID 171263078) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 4-[(1R,2S)-1-amino-2-hydroxypentyl]-3,5-dimethoxyphenol.
| Compound Name | 4-[(1R,2S)-1-amino-2-hydroxypentyl]-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 171263078 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 4-[(1R,2S)-1-amino-2-hydroxypentyl]-3,5-dimethoxyphenol |
| SMILES | CCC[C@H](O)[C@H](N)c1c(OC)cc(O)cc1OC |
| InChI | InChI=1S/C13H21NO4/c1-4-5-9(16)13(14)12-10(17-2)6-8(15)7-11(12)18-3/h6-7,9,13,15-16H,4-5,14H2,1-3H3/t9-,13-/m0/s1 |
| InChIKey | BBFPRSJFCKVHBI-ZANVPECISA-N |
| XLogP | 1.57 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |