C13H16O6 — CID 117424076
2-hydroxy-2-[2-methoxy-3-(oxolan-3-yloxy)phenyl]acetic acid (PubChem CID 117424076) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is 2-hydroxy-2-[2-methoxy-3-(oxolan-3-yloxy)phenyl]acetic acid.
| Compound Name | 2-hydroxy-2-[2-methoxy-3-(oxolan-3-yloxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 117424076 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-hydroxy-2-[2-methoxy-3-(oxolan-3-yloxy)phenyl]acetic acid |
| SMILES | COc1c(OC2CCOC2)cccc1C(O)C(=O)O |
| InChI | InChI=1S/C13H16O6/c1-17-12-9(11(14)13(15)16)3-2-4-10(12)19-8-5-6-18-7-8/h2-4,8,11,14H,5-7H2,1H3,(H,15,16) |
| InChIKey | YOPGXFXNJLDFKB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |