C15H21ClO3 — CID 103452210
1-[(4-chloro-3-methoxyphenyl)-hydroxymethyl]cycloheptan-1-ol (PubChem CID 103452210) has the molecular formula C15H21ClO3 and a molecular weight of 284.78 g/mol. Its IUPAC name is 1-[(4-chloro-3-methoxyphenyl)-hydroxymethyl]cycloheptan-1-ol.
| Compound Name | 1-[(4-chloro-3-methoxyphenyl)-hydroxymethyl]cycloheptan-1-ol |
|---|---|
| PubChem CID | 103452210 |
| Molecular Formula | C15H21ClO3 |
| Molecular Weight | 284.78 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 1-[(4-chloro-3-methoxyphenyl)-hydroxymethyl]cycloheptan-1-ol |
| SMILES | COc1cc(C(O)C2(O)CCCCCC2)ccc1Cl |
| InChI | InChI=1S/C15H21ClO3/c1-19-13-10-11(6-7-12(13)16)14(17)15(18)8-4-2-3-5-9-15/h6-7,10,14,17-18H,2-5,8-9H2,1H3 |
| InChIKey | ASYQLPLRFKNCQO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.78 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |