C16H22BrFO2 — CID 106828562
1-[bromo-(1-methylcyclohexyl)methyl]-2-fluoro-4,5-dimethoxybenzene (PubChem CID 106828562) has the molecular formula C16H22BrFO2 and a molecular weight of 345.25 g/mol. Its IUPAC name is 1-[bromo-(1-methylcyclohexyl)methyl]-2-fluoro-4,5-dimethoxybenzene.
| Compound Name | 1-[bromo-(1-methylcyclohexyl)methyl]-2-fluoro-4,5-dimethoxybenzene |
|---|---|
| PubChem CID | 106828562 |
| Molecular Formula | C16H22BrFO2 |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 1-[bromo-(1-methylcyclohexyl)methyl]-2-fluoro-4,5-dimethoxybenzene |
| SMILES | COc1cc(F)c(C(Br)C2(C)CCCCC2)cc1OC |
| InChI | InChI=1S/C16H22BrFO2/c1-16(7-5-4-6-8-16)15(17)11-9-13(19-2)14(20-3)10-12(11)18/h9-10,15H,4-8H2,1-3H3 |
| InChIKey | JPDVHWQNSXRQSR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|