C17H16BrClO2 — CID 66395194
7-[bromo-(2-chloro-4,5-dimethoxyphenyl)methyl]bicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 66395194) has the molecular formula C17H16BrClO2 and a molecular weight of 367.67 g/mol. Its IUPAC name is 7-[bromo-(2-chloro-4,5-dimethoxyphenyl)methyl]bicyclo[4.2.0]octa-1,3,5-triene.
| Compound Name | 7-[bromo-(2-chloro-4,5-dimethoxyphenyl)methyl]bicyclo[4.2.0]octa-1,3,5-triene |
|---|---|
| PubChem CID | 66395194 |
| Molecular Formula | C17H16BrClO2 |
| Molecular Weight | 367.67 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 7-[bromo-(2-chloro-4,5-dimethoxyphenyl)methyl]bicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | COc1cc(Cl)c(C(Br)C2Cc3ccccc32)cc1OC |
| InChI | InChI=1S/C17H16BrClO2/c1-20-15-8-13(14(19)9-16(15)21-2)17(18)12-7-10-5-3-4-6-11(10)12/h3-6,8-9,12,17H,7H2,1-2H3 |
| InChIKey | PGYZXJMQKXPISX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.67 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|