C17H16Br2O — CID 66395777
7-[bromo-(5-bromo-2-ethoxyphenyl)methyl]bicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 66395777) has the molecular formula C17H16Br2O and a molecular weight of 396.12 g/mol. Its IUPAC name is 7-[bromo-(5-bromo-2-ethoxyphenyl)methyl]bicyclo[4.2.0]octa-1,3,5-triene.
| Compound Name | 7-[bromo-(5-bromo-2-ethoxyphenyl)methyl]bicyclo[4.2.0]octa-1,3,5-triene |
|---|---|
| PubChem CID | 66395777 |
| Molecular Formula | C17H16Br2O |
| Molecular Weight | 396.12 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | 7-[bromo-(5-bromo-2-ethoxyphenyl)methyl]bicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | CCOc1ccc(Br)cc1C(Br)C1Cc2ccccc21 |
| InChI | InChI=1S/C17H16Br2O/c1-2-20-16-8-7-12(18)10-15(16)17(19)14-9-11-5-3-4-6-13(11)14/h3-8,10,14,17H,2,9H2,1H3 |
| InChIKey | CRWCKPULJNEXPP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.12 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|