C15H12Br4O — CID 107980915
1,3-dibromo-5-[bromo-(5-bromo-2-ethoxyphenyl)methyl]benzene (PubChem CID 107980915) has the molecular formula C15H12Br4O and a molecular weight of 527.88 g/mol. Its IUPAC name is 1,3-dibromo-5-[bromo-(5-bromo-2-ethoxyphenyl)methyl]benzene.
| Compound Name | 1,3-dibromo-5-[bromo-(5-bromo-2-ethoxyphenyl)methyl]benzene |
|---|---|
| PubChem CID | 107980915 |
| Molecular Formula | C15H12Br4O |
| Molecular Weight | 527.88 g/mol |
| Exact Mass | 523.76 |
| IUPAC Name | 1,3-dibromo-5-[bromo-(5-bromo-2-ethoxyphenyl)methyl]benzene |
| SMILES | CCOc1ccc(Br)cc1C(Br)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C15H12Br4O/c1-2-20-14-4-3-10(16)8-13(14)15(19)9-5-11(17)7-12(18)6-9/h3-8,15H,2H2,1H3 |
| InChIKey | GXMAFQZJSBOZRL-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.88 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|