C15H11Br2F3O — CID 65100839
2-[bromo-(5-bromo-2-ethoxyphenyl)methyl]-1,3,5-trifluorobenzene (PubChem CID 65100839) has the molecular formula C15H11Br2F3O and a molecular weight of 424.05 g/mol. Its IUPAC name is 2-[bromo-(5-bromo-2-ethoxyphenyl)methyl]-1,3,5-trifluorobenzene.
| Compound Name | 2-[bromo-(5-bromo-2-ethoxyphenyl)methyl]-1,3,5-trifluorobenzene |
|---|---|
| PubChem CID | 65100839 |
| Molecular Formula | C15H11Br2F3O |
| Molecular Weight | 424.05 g/mol |
| Exact Mass | 421.91 |
| IUPAC Name | 2-[bromo-(5-bromo-2-ethoxyphenyl)methyl]-1,3,5-trifluorobenzene |
| SMILES | CCOc1ccc(Br)cc1C(Br)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C15H11Br2F3O/c1-2-21-13-4-3-8(16)5-10(13)15(17)14-11(19)6-9(18)7-12(14)20/h3-7,15H,2H2,1H3 |
| InChIKey | MDSAJUFJNOZBLN-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.05 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|