C17H24Br2 — CID 107182405
1-bromo-4-[bromo-(2,2-dimethylcyclohexyl)methyl]-2,5-dimethylbenzene (PubChem CID 107182405) has the molecular formula C17H24Br2 and a molecular weight of 388.19 g/mol. Its IUPAC name is 1-bromo-4-[bromo-(2,2-dimethylcyclohexyl)methyl]-2,5-dimethylbenzene.
| Compound Name | 1-bromo-4-[bromo-(2,2-dimethylcyclohexyl)methyl]-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 107182405 |
| Molecular Formula | C17H24Br2 |
| Molecular Weight | 388.19 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 1-bromo-4-[bromo-(2,2-dimethylcyclohexyl)methyl]-2,5-dimethylbenzene |
| SMILES | Cc1cc(C(Br)C2CCCCC2(C)C)c(C)cc1Br |
| InChI | InChI=1S/C17H24Br2/c1-11-10-15(18)12(2)9-13(11)16(19)14-7-5-6-8-17(14,3)4/h9-10,14,16H,5-8H2,1-4H3 |
| InChIKey | PCTFBTNQSYRIBC-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.19 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|