C13H18Br2S — CID 107182444
3-bromo-2-[bromo-(2,2-dimethylcyclopentyl)methyl]-5-methylthiophene (PubChem CID 107182444) has the molecular formula C13H18Br2S and a molecular weight of 366.16 g/mol. Its IUPAC name is 3-bromo-2-[bromo-(2,2-dimethylcyclopentyl)methyl]-5-methylthiophene.
| Compound Name | 3-bromo-2-[bromo-(2,2-dimethylcyclopentyl)methyl]-5-methylthiophene |
|---|---|
| PubChem CID | 107182444 |
| Molecular Formula | C13H18Br2S |
| Molecular Weight | 366.16 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | 3-bromo-2-[bromo-(2,2-dimethylcyclopentyl)methyl]-5-methylthiophene |
| SMILES | Cc1cc(Br)c(C(Br)C2CCCC2(C)C)s1 |
| InChI | InChI=1S/C13H18Br2S/c1-8-7-10(14)12(16-8)11(15)9-5-4-6-13(9,2)3/h7,9,11H,4-6H2,1-3H3 |
| InChIKey | JTAKBHZTNWLCLH-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.16 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|